* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB021367 |
| English Synonyms: | VITAS-BB TBB021367 |
| MDL Number.: | MFCD02176083 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCCCOC1=CC=C(\C=N\NC(=O)C2=CC=CO2)C=C1OCC |
| InChi: | InChI=1S/C18H22N2O4/c1-3-5-10-23-15-9-8-14(12-17(15)22-4-2)13-19-20-18(21)16-7-6-11-24-16/h6-9,11-13H,3-5,10H2,1-2H3,(H,20,21)/b19-13+ |
| InChiKey: | InChIKey=MROKNEMBNKYHSP-CPNJWEJPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.