* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021038 |
English Synonyms: | VITAS-BB TBB021038 |
MDL Number.: | MFCD02176182 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCOC1=CC=CC(=C1)C1=CC(C(=O)NC2=C(C(N)=O)C3=C(CCCCCCCCCC3)S2)=C2C=CC=CC2=N1 |
InChi: | InChI=1S/C33H37N3O3S/c1-2-39-23-15-13-14-22(20-23)28-21-26(24-16-11-12-18-27(24)35-28)32(38)36-33-30(31(34)37)25-17-9-7-5-3-4-6-8-10-19-29(25)40-33/h11-16,18,20-21H,2-10,17,19H2,1H3,(H2,34,37)(H,36,38) |
InChiKey: | InChIKey=OGYYAHGOTJIZAL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.