* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024555 |
English Synonyms: | VITAS-BB TBB024555 |
MDL Number.: | MFCD02176202 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | COC1=CC(\C=N\NC(=O)CCC2=CC(O)=C(O)C=C2)=CC=C1OCC1=CC=CC=C1 |
InChi: | InChI=1S/C24H24N2O5/c1-30-23-14-19(8-11-22(23)31-16-18-5-3-2-4-6-18)15-25-26-24(29)12-9-17-7-10-20(27)21(28)13-17/h2-8,10-11,13-15,27-28H,9,12,16H2,1H3,(H,26,29)/b25-15+ |
InChiKey: | InChIKey=XNFJZUKQJGAVKK-MFKUBSTISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.