* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020391 |
English Synonyms: | VITAS-BB TBB020391 |
MDL Number.: | MFCD02176224 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COC(=O)C1=C(NC(=O)C2=C3C=C(Br)C=CC3=NC(=C2)C2=CC=CC=C2)SC2=C1CCC(C2)C1=CC=CC=C1 |
InChi: | InChI=1S/C32H25BrN2O3S/c1-38-32(37)29-23-14-12-21(19-8-4-2-5-9-19)16-28(23)39-31(29)35-30(36)25-18-27(20-10-6-3-7-11-20)34-26-15-13-22(33)17-24(25)26/h2-11,13,15,17-18,21H,12,14,16H2,1H3,(H,35,36) |
InChiKey: | InChIKey=RZOMZMVXSNDIRU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.