* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020899 |
English Synonyms: | VITAS-BB TBB020899 |
MDL Number.: | MFCD02176249 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCOC1=CC=C(C=C1)C(\CC)=N\NC(=O)C1(C)CC1(Br)Br |
InChi: | InChI=1S/C17H22Br2N2O2/c1-4-10-23-13-8-6-12(7-9-13)14(5-2)20-21-15(22)16(3)11-17(16,18)19/h6-9H,4-5,10-11H2,1-3H3,(H,21,22)/b20-14+ |
InChiKey: | InChIKey=JZJCPZOBTUPRMA-XSFVSMFZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.