* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020827 |
English Synonyms: | VITAS-BB TBB020827 |
MDL Number.: | MFCD02176361 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCC1=C(C)SC(NC(=O)C2=C(Cl)C3=C(S2)C=C(Cl)C=C3)=C1C(N)=O |
InChi: | InChI=1S/C17H14Cl2N2O2S2/c1-3-9-7(2)24-17(12(9)15(20)22)21-16(23)14-13(19)10-5-4-8(18)6-11(10)25-14/h4-6H,3H2,1-2H3,(H2,20,22)(H,21,23) |
InChiKey: | InChIKey=MSSLQBANZDJKLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.