* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021702 |
English Synonyms: | VITAS-BB TBB021702 |
MDL Number.: | MFCD02176372 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCCOC1=CC=C(\C=N\NC(=O)C2=C(Cl)C3=C(S2)C=C(C)C=C3)C=C1OCC |
InChi: | InChI=1S/C23H25ClN2O3S/c1-4-6-11-29-18-10-8-16(13-19(18)28-5-2)14-25-26-23(27)22-21(24)17-9-7-15(3)12-20(17)30-22/h7-10,12-14H,4-6,11H2,1-3H3,(H,26,27)/b25-14+ |
InChiKey: | InChIKey=WOSKKGPULCUEQE-AFUMVMLFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.