* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020384 |
English Synonyms: | VITAS-BB TBB020384 |
MDL Number.: | MFCD02176382 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COC(=O)C1=C(NC(=O)C2=C3C=C(Br)C=CC3=NC(=C2)C2=CC=C(C)C=C2)SC2=C1CCC(C2)C(C)(C)C |
InChi: | InChI=1S/C31H31BrN2O3S/c1-17-6-8-18(9-7-17)25-16-23(22-15-20(32)11-13-24(22)33-25)28(35)34-29-27(30(36)37-5)21-12-10-19(31(2,3)4)14-26(21)38-29/h6-9,11,13,15-16,19H,10,12,14H2,1-5H3,(H,34,35) |
InChiKey: | InChIKey=SVJGVRKETTVUDW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.