* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020518 |
English Synonyms: | VITAS-BB TBB020518 |
MDL Number.: | MFCD02176390 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COC(=O)C1=C(NC(=O)C2=C3C=C(Br)C=CC3=NC(=C2)C2=CC=CC=C2)SC=C1C1=CC=C(OC)C=C1 |
InChi: | InChI=1S/C29H21BrN2O4S/c1-35-20-11-8-17(9-12-20)23-16-37-28(26(23)29(34)36-2)32-27(33)22-15-25(18-6-4-3-5-7-18)31-24-13-10-19(30)14-21(22)24/h3-16H,1-2H3,(H,32,33) |
InChiKey: | InChIKey=KGLZJBBRQDQUSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.