* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020876 |
English Synonyms: | VITAS-BB TBB020876 |
MDL Number.: | MFCD02176458 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCCOC(=O)C1=C(NC(=O)C2C3CCC(C3)C2C(O)=O)SC(C)=C1C1=CC=C(OC)C=C1 |
InChi: | InChI=1S/C25H29NO6S/c1-4-11-32-25(30)21-18(14-7-9-17(31-3)10-8-14)13(2)33-23(21)26-22(27)19-15-5-6-16(12-15)20(19)24(28)29/h7-10,15-16,19-20H,4-6,11-12H2,1-3H3,(H,26,27)(H,28,29) |
InChiKey: | InChIKey=NGTDSVJFIOHGJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.