* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB022802 |
English Synonyms: | VITAS-BB TBB022802 |
MDL Number.: | MFCD02176481 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | ClC1=CC=C(NC(=O)C2=C(NC(=O)CCCC3=CC=CC=C3)SC3=C2CCCC3)C=C1 |
InChi: | InChI=1S/C25H25ClN2O2S/c26-18-13-15-19(16-14-18)27-24(30)23-20-10-4-5-11-21(20)31-25(23)28-22(29)12-6-9-17-7-2-1-3-8-17/h1-3,7-8,13-16H,4-6,9-12H2,(H,27,30)(H,28,29) |
InChiKey: | InChIKey=JOCCIIDJVHRXKB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.