* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021201 |
English Synonyms: | VITAS-BB TBB021201 |
MDL Number.: | MFCD02176542 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COC(=O)C1=C(NC(=O)C2=C3C=CC=CC3=NC(=C2)C2=CC(C)=C(C)C=C2)SC=C1C1=CC=C(Cl)C=C1 |
InChi: | InChI=1S/C30H23ClN2O3S/c1-17-8-9-20(14-18(17)2)26-15-23(22-6-4-5-7-25(22)32-26)28(34)33-29-27(30(35)36-3)24(16-37-29)19-10-12-21(31)13-11-19/h4-16H,1-3H3,(H,33,34) |
InChiKey: | InChIKey=JASGOMSHCSCRPD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.