* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021395 |
English Synonyms: | VITAS-BB TBB021395 |
MDL Number.: | MFCD02176595 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCCCOC1=CC=C(\C=N\NC(=O)C2=C(C)OC=C2)C=C1OCC |
InChi: | InChI=1S/C19H24N2O4/c1-4-6-10-25-17-8-7-15(12-18(17)23-5-2)13-20-21-19(22)16-9-11-24-14(16)3/h7-9,11-13H,4-6,10H2,1-3H3,(H,21,22)/b20-13+ |
InChiKey: | InChIKey=CEIQRKQEVRLKBF-DEDYPNTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.