* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020882 |
English Synonyms: | VITAS-BB TBB020882 |
MDL Number.: | MFCD02176648 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | COC(=O)C1=C(NC(=O)C2C3CCC(C3)C2C(O)=O)SC=C1C1=C(C)C=CC(C)=C1 |
InChi: | InChI=1S/C23H25NO5S/c1-11-4-5-12(2)15(8-11)16-10-30-21(19(16)23(28)29-3)24-20(25)17-13-6-7-14(9-13)18(17)22(26)27/h4-5,8,10,13-14,17-18H,6-7,9H2,1-3H3,(H,24,25)(H,26,27) |
InChiKey: | InChIKey=ICYDCUUFBAPBHR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.