* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020875 |
English Synonyms: | VITAS-BB TBB020875 |
MDL Number.: | MFCD02176726 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCOC(=O)C1=C(NC(=O)C2C3CCC(C3)C2C(O)=O)SC(C)=C1 |
InChi: | InChI=1S/C17H21NO5S/c1-3-23-17(22)11-6-8(2)24-15(11)18-14(19)12-9-4-5-10(7-9)13(12)16(20)21/h6,9-10,12-13H,3-5,7H2,1-2H3,(H,18,19)(H,20,21) |
InChiKey: | InChIKey=OMKVUZTWFUHSOQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.