* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024557 |
English Synonyms: | VITAS-BB TBB024557 |
MDL Number.: | MFCD02176890 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CCCOC1=CC=C(\C=N\NC(=O)CCC2=CC(O)=C(O)C=C2)C=C1OC |
InChi: | InChI=1S/C20H24N2O5/c1-3-10-27-18-8-5-15(12-19(18)26-2)13-21-22-20(25)9-6-14-4-7-16(23)17(24)11-14/h4-5,7-8,11-13,23-24H,3,6,9-10H2,1-2H3,(H,22,25)/b21-13+ |
InChiKey: | InChIKey=CMMAVBHZCFEHIG-FYJGNVAPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.