* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024558 |
English Synonyms: | VITAS-BB TBB024558 |
MDL Number.: | MFCD02176932 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | COC1=C(OCCN2CCOCC2)C=CC(\C=N\NC(=O)CCC2=CC(O)=C(O)C=C2)=C1 |
InChi: | InChI=1S/C23H29N3O6/c1-30-22-15-18(3-6-21(22)32-13-10-26-8-11-31-12-9-26)16-24-25-23(29)7-4-17-2-5-19(27)20(28)14-17/h2-3,5-6,14-16,27-28H,4,7-13H2,1H3,(H,25,29)/b24-16+ |
InChiKey: | InChIKey=RHFXJAMBZOFJLE-LFVJCYFKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.