* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020411 |
English Synonyms: | VITAS-BB TBB020411 |
MDL Number.: | MFCD02176959 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCCNC(=O)C(=C/C1=CNN=C1C1=CC(OC)=C(OC)C=C1)\C#N |
InChi: | InChI=1S/C18H20N4O3/c1-4-7-20-18(23)13(10-19)8-14-11-21-22-17(14)12-5-6-15(24-2)16(9-12)25-3/h5-6,8-9,11H,4,7H2,1-3H3,(H,20,23)(H,21,22)/b13-8- |
InChiKey: | InChIKey=BRDUZRZXWCJGKL-JYRVWZFOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.