* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020774 |
English Synonyms: | VITAS-BB TBB020774 |
MDL Number.: | MFCD02176996 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | O=C(NC1CCN(CC2=CC=CC=C2)CC1)C1=CC(=CC(=C1)C(=O)NC1CCN(CC2=CC=CC=C2)CC1)C(=O)NC1CCN(CC2=CC=CC=C2)CC1 |
InChi: | InChI=1S/C45H54N6O3/c52-43(46-40-16-22-49(23-17-40)31-34-10-4-1-5-11-34)37-28-38(44(53)47-41-18-24-50(25-19-41)32-35-12-6-2-7-13-35)30-39(29-37)45(54)48-42-20-26-51(27-21-42)33-36-14-8-3-9-15-36/h1-15,28-30,40-42H,16-27,31-33H2,(H,46,52)(H,47,53)(H,48,54) |
InChiKey: | InChIKey=WJUOPSPFQSXVSK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.