* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020501 |
English Synonyms: | VITAS-BB TBB020501 |
MDL Number.: | MFCD02177002 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC(=O)C(=C/C1=CNN=C1C1=CC=C(C)C=C1)\C#N |
InChi: | InChI=1S/C16H15N3O2/c1-3-21-16(20)13(9-17)8-14-10-18-19-15(14)12-6-4-11(2)5-7-12/h4-8,10H,3H2,1-2H3,(H,18,19)/b13-8- |
InChiKey: | InChIKey=DKCSTCFVHHTAFQ-JYRVWZFOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.