* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020773 |
English Synonyms: | VITAS-BB TBB020773 |
MDL Number.: | MFCD02177018 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | O=C(NCC1=CC=CS1)C1=CC(=CC(=C1)C(=O)NCC1=CC=CS1)C(=O)NCC1=CC=CS1 |
InChi: | InChI=1S/C24H21N3O3S3/c28-22(25-13-19-4-1-7-31-19)16-10-17(23(29)26-14-20-5-2-8-32-20)12-18(11-16)24(30)27-15-21-6-3-9-33-21/h1-12H,13-15H2,(H,25,28)(H,26,29)(H,27,30) |
InChiKey: | InChIKey=DGSBVDOJVVJECX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.