* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020785 |
English Synonyms: | VITAS-BB TBB020785 |
MDL Number.: | MFCD02177032 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | NC(=O)C1=C(NC(=O)CCCC2=CC=CC=C2)SC2=C1CCCC2 |
InChi: | InChI=1S/C19H22N2O2S/c20-18(23)17-14-10-4-5-11-15(14)24-19(17)21-16(22)12-6-9-13-7-2-1-3-8-13/h1-3,7-8H,4-6,9-12H2,(H2,20,23)(H,21,22) |
InChiKey: | InChIKey=GTAYYLHALSJLSL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.