* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020779 |
English Synonyms: | VITAS-BB TBB020779 |
MDL Number.: | MFCD02177036 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CSC1=CC=CC=C1NC(=O)C1=CC(=CC(=C1)C(=O)NC1=C(SC)C=CC=C1)C(=O)NC1=C(SC)C=CC=C1 |
InChi: | InChI=1S/C30H27N3O3S3/c1-37-25-13-7-4-10-22(25)31-28(34)19-16-20(29(35)32-23-11-5-8-14-26(23)38-2)18-21(17-19)30(36)33-24-12-6-9-15-27(24)39-3/h4-18H,1-3H3,(H,31,34)(H,32,35)(H,33,36) |
InChiKey: | InChIKey=FLZPYCNVBPHSPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.