* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020565 |
English Synonyms: | VITAS-BB TBB020565 |
MDL Number.: | MFCD02177050 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | ClC1=CC=C(C=C1)C1=NNC=C1\C=C(\C#N)C(=O)NC1CCCCCC1 |
InChi: | InChI=1S/C20H21ClN4O/c21-17-9-7-14(8-10-17)19-16(13-23-25-19)11-15(12-22)20(26)24-18-5-3-1-2-4-6-18/h7-11,13,18H,1-6H2,(H,23,25)(H,24,26)/b15-11- |
InChiKey: | InChIKey=CTINWIYZXXZCGJ-PTNGSMBKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.