* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020472 |
English Synonyms: | VITAS-BB TBB020472 |
MDL Number.: | MFCD02177098 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | ClC1=CC=C(C=C1)C1=NN(C=C1\C=C(\C#N)C(=O)NC1CCCCC1)C1=CC=CC=C1 |
InChi: | InChI=1S/C25H23ClN4O/c26-21-13-11-18(12-14-21)24-20(17-30(29-24)23-9-5-2-6-10-23)15-19(16-27)25(31)28-22-7-3-1-4-8-22/h2,5-6,9-15,17,22H,1,3-4,7-8H2,(H,28,31)/b19-15- |
InChiKey: | InChIKey=PAHAJTOCINJBQJ-CYVLTUHYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.