* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB020630 |
| English Synonyms: | VITAS-BB TBB020630 |
| MDL Number.: | MFCD02177103 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCOC(=O)C1=C(NC(=O)C2=C(F)C=CC=C2F)SC(C)=C1C1=CC=C(C=C1)C(C)(C)C |
| InChi: | InChI=1S/C26H27F2NO3S/c1-6-14-32-25(31)22-20(16-10-12-17(13-11-16)26(3,4)5)15(2)33-24(22)29-23(30)21-18(27)8-7-9-19(21)28/h7-13H,6,14H2,1-5H3,(H,29,30) |
| InChiKey: | InChIKey=JTAZRRHZNLRTTH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.