* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB020770 |
| English Synonyms: | VITAS-BB TBB020770 |
| MDL Number.: | MFCD02177185 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | COC1=CC=C(CCNC(=O)C2=CC(=CC(=C2)C(=O)NCCC2=CC=C(OC)C=C2)C(=O)NCCC2=CC=C(OC)C=C2)C=C1 |
| InChi: | InChI=1S/C36H39N3O6/c1-43-31-10-4-25(5-11-31)16-19-37-34(40)28-22-29(35(41)38-20-17-26-6-12-32(44-2)13-7-26)24-30(23-28)36(42)39-21-18-27-8-14-33(45-3)15-9-27/h4-15,22-24H,16-21H2,1-3H3,(H,37,40)(H,38,41)(H,39,42) |
| InChiKey: | InChIKey=KRVFTGKCJHICCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.