* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020457 |
English Synonyms: | VITAS-BB TBB020457 |
MDL Number.: | MFCD02177302 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1=C(NC(=O)C2=C3C=CC=CC3=NC(=C2)C2=CC=C(CC(C)C)C=C2)SC(C)=C1C1=CC=C(C=C1)C(C)C |
InChi: | InChI=1S/C37H38N2O3S/c1-7-42-37(41)34-33(28-18-16-26(17-19-28)23(4)5)24(6)43-36(34)39-35(40)30-21-32(38-31-11-9-8-10-29(30)31)27-14-12-25(13-15-27)20-22(2)3/h8-19,21-23H,7,20H2,1-6H3,(H,39,40) |
InChiKey: | InChIKey=DNTFOYPBDMHKKW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.