* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-CHLORO-3-METHYL-2,5-DIHYDRO-1H-PHOSPHOLE |
| CAS: | 28273-35-0 |
| English Synonyms: | 1-CHLORO-3-METHYL-2,5-DIHYDRO-1H-PHOSPHOLE |
| MDL Number.: | MFCD02177903 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CC1=CCP(C1)Cl |
| InChi: | InChI=1S/C5H8ClP/c1-5-2-3-7(6)4-5/h2H,3-4H2,1H3 |
| InChiKey: | InChIKey=HUMPNEBBCNEZKL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.