* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-1H-PYRROLO[2,3-C]PYRIDIN-2(3H)-ONE |
| CAS: | 178393-20-9 |
| English Synonyms: | 7-CHLORO-1H-PYRROLO[2,3-C]PYRIDIN-2(3H)-ONE ; ABBYPHARMA AP-11-10146 ; 7-CHLORO-6-AZA-2-OXINDOLE ; 7-CHLORO-1H,2H,3H-PYRROLO[2,3-C]PYRIDIN-2-ONE |
| MDL Number.: | MFCD02179620 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cnc(c2c1CC(=O)N2)Cl |
| InChi: | InChI=1S/C7H5ClN2O/c8-7-6-4(1-2-9-7)3-5(11)10-6/h1-2H,3H2,(H,10,11) |
| InChiKey: | InChIKey=JHSXMNUYBFUKFP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.