* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL ACETATE, [2-14C]- |
English Synonyms: | ETHYL ACETATE, [2-14C]- |
MDL Number.: | MFCD02181004 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCOC([14CH3])=O |
InChi: | InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3/i2+2 |
InChiKey: | InChIKey=XEKOWRVHYACXOJ-HQMMCQRPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.