* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUCOSE OCTYLAMINE |
| English Synonyms: | GLUCOSE OCTYLAMINE |
| MDL Number.: | MFCD02181152 |
| H bond acceptor: | 6 |
| H bond donor: | 5 |
| Smile: | CCCCCCCCN[C@@H]1[C@H]([C@@H]([C@H](OC1O)CO)O)O |
| InChi: | InChI=1S/C14H29NO5/c1-2-3-4-5-6-7-8-15-11-13(18)12(17)10(9-16)20-14(11)19/h10-19H,2-9H2,1H3/t10-,11-,12-,13-,14?/m1/s1 |
| InChiKey: | InChIKey=SLOKJLOOUPQTLF-GNMOMJPPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.