* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(2-THIENYL)[1,2,4]TRIAZOLO[4,3-A]PYRIMIDINE |
| CAS: | 255389-52-7 |
| English Synonyms: | 7-(2-THIENYL)[1,2,4]TRIAZOLO[4,3-A]PYRIMIDINE ; 7-(THIOPHEN-2-YL)-[1,2,4]TRIAZOLO[4,3-A]PYRIMIDINE |
| MDL Number.: | MFCD02181968 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cc(sc1)c2ccn3cnnc3n2 |
| InChi: | InChI=1S/C9H6N4S/c1-2-8(14-5-1)7-3-4-13-6-10-12-9(13)11-7/h1-6H |
| InChiKey: | InChIKey=NSYIVXUELSMVMD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.