* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 2-[2-(PROP-2-ENYLAMINO)-1,3-THIAZOL-4-YL]ACETATE |
| English Synonyms: | ETHYL 2-[2-(PROP-2-ENYLAMINO)-1,3-THIAZOL-4-YL]ACETATE |
| MDL Number.: | MFCD02187588 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)Cc1csc(n1)NCC=C |
| InChi: | InChI=1S/C10H14N2O2S/c1-3-5-11-10-12-8(7-15-10)6-9(13)14-4-2/h3,7H,1,4-6H2,2H3,(H,11,12) |
| InChiKey: | InChIKey=HHSLGYAHOAGJCS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.