* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB036101 |
English Synonyms: | VITAS-BB TBB036101 |
MDL Number.: | MFCD02188574 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | COC1=C(OCC2=CC=CC=C2)C=C(C=C1)C1C(C(=O)OCCOC2=CC=CC=C2)=C(C)NC2=C1C(=O)CCC2 |
InChi: | InChI=1S/C33H33NO6/c1-22-30(33(36)39-19-18-38-25-12-7-4-8-13-25)31(32-26(34-22)14-9-15-27(32)35)24-16-17-28(37-2)29(20-24)40-21-23-10-5-3-6-11-23/h3-8,10-13,16-17,20,31,34H,9,14-15,18-19,21H2,1-2H3 |
InChiKey: | InChIKey=VLXLDFDHOQYYOH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.