* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036104 |
| English Synonyms: | VITAS-BB TBB036104 |
| MDL Number.: | MFCD02188594 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COC1=C(C=C(Br)C=C1)C1C(C(=O)OCC2CCCO2)=C(C)NC2=C1C(=O)CC(C)(C)C2 |
| InChi: | InChI=1S/C25H30BrNO5/c1-14-21(24(29)32-13-16-6-5-9-31-16)22(17-10-15(26)7-8-20(17)30-4)23-18(27-14)11-25(2,3)12-19(23)28/h7-8,10,16,22,27H,5-6,9,11-13H2,1-4H3 |
| InChiKey: | InChIKey=LRVNTWKVTBZGAU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.