* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB015286 |
English Synonyms: | VITAS-BB TBB015286 |
MDL Number.: | MFCD02189067 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | ClC1=CC=C(C=C1)C(=O)COC(=O)CCN1C(=O)C2C(C3C=CC2C2CC32)C1=O |
InChi: | InChI=1S/C22H20ClNO5/c23-12-3-1-11(2-4-12)17(25)10-29-18(26)7-8-24-21(27)19-13-5-6-14(16-9-15(13)16)20(19)22(24)28/h1-6,13-16,19-20H,7-10H2 |
InChiKey: | InChIKey=ADDPCWMDRBWVFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.