* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB015288 |
English Synonyms: | VITAS-BB TBB015288 |
MDL Number.: | MFCD02189081 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | COC1=CC=C(C=C1)C(=O)COC(=O)C1=CC=C(C=C1)N1C(=O)C2C(C3C=CC2C2CC32)C1=O |
InChi: | InChI=1S/C27H23NO6/c1-33-17-8-4-14(5-9-17)22(29)13-34-27(32)15-2-6-16(7-3-15)28-25(30)23-18-10-11-19(21-12-20(18)21)24(23)26(28)31/h2-11,18-21,23-24H,12-13H2,1H3 |
InChiKey: | InChIKey=YGHMMPCQGXMSSQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.