* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB015293 |
English Synonyms: | VITAS-BB TBB015293 |
MDL Number.: | MFCD02189113 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC(OC(=O)C1=CC=CC=C1N1C(=O)C2C(C3C=CC2C2CC32)C1=O)C(=O)C1=CC=CC=C1 |
InChi: | InChI=1S/C27H23NO5/c1-14(24(29)15-7-3-2-4-8-15)33-27(32)18-9-5-6-10-21(18)28-25(30)22-16-11-12-17(20-13-19(16)20)23(22)26(28)31/h2-12,14,16-17,19-20,22-23H,13H2,1H3 |
InChiKey: | InChIKey=VDRFPLUIQRTPGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.