Molecular Structure:
CCD No.:CCD00299755
OTAVA-BB 1357593
Formula:C16 H20 N2 O3
MolWeight:288.345
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1357593 |
| English Synonyms： | OTAVA-BB 1357593 |
| MDL Number.： | MFCD02209145 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | Cc1cccc(c1C)N2CCN(CC2)C(=O)/C=C\C(=O)O |
| InChi： | InChI=1S/C16H20N2O3/c1-12-4-3-5-14(13(12)2)17-8-10-18(11-9-17)15(19)6-7-16(20)21/h3-7H,8-11H2,1-2H3,(H,20,21)/b7-6- |
| InChiKey： | InChIKey=BMXLOLRRPAHQFF-SREVYHEPSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
