* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 15925607 |
| English Synonyms: | EMOLECULES 15925607 |
| MDL Number.: | MFCD02214705 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(c(c1)C)OCC(CN2CC(CC(C2)C)C)O.Cl |
| InChi: | InChI=1S/C18H29NO2.ClH/c1-13-5-6-18(16(4)8-13)21-12-17(20)11-19-9-14(2)7-15(3)10-19;/h5-6,8,14-15,17,20H,7,9-12H2,1-4H3;1H |
| InChiKey: | InChIKey=CSWLWXVZPYUQLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.