* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 1452820 |
English Synonyms: | EMOLECULES 1452820 |
MDL Number.: | MFCD02220722 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CN1CCN(CC1)CC(COc2cccc(c2)OC)O.Cl.Cl |
InChi: | InChI=1S/C15H24N2O3.2ClH/c1-16-6-8-17(9-7-16)11-13(18)12-20-15-5-3-4-14(10-15)19-2;;/h3-5,10,13,18H,6-9,11-12H2,1-2H3;2*1H |
InChiKey: | InChIKey=WVTTXKUWFBCZRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.