* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 2569045 |
| English Synonyms: | EMOLECULES 2569045 |
| MDL Number.: | MFCD02220842 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC1CCCC(N1CC(COc2cccc(c2)OC)O)C.Cl |
| InChi: | InChI=1S/C17H27NO3.ClH/c1-13-6-4-7-14(2)18(13)11-15(19)12-21-17-9-5-8-16(10-17)20-3;/h5,8-10,13-15,19H,4,6-7,11-12H2,1-3H3;1H |
| InChiKey: | InChIKey=KWQPLLORDNJFBD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.