* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036213 |
| English Synonyms: | VITAS-BB TBB036213 |
| MDL Number.: | MFCD02224173 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | COCCOC(=O)C1=C(C)NC2=C(C1C1=CC(Cl)=CC=C1)C(=O)CC(C2)C1=CC(OC)=C(OC)C=C1 |
| InChi: | InChI=1S/C28H30ClNO6/c1-16-25(28(32)36-11-10-33-2)26(18-6-5-7-20(29)12-18)27-21(30-16)13-19(14-22(27)31)17-8-9-23(34-3)24(15-17)35-4/h5-9,12,15,19,26,30H,10-11,13-14H2,1-4H3 |
| InChiKey: | InChIKey=QDZDCGWSOZHJPP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.