* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB036214 |
English Synonyms: | VITAS-BB TBB036214 |
MDL Number.: | MFCD02224174 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | COC1=C(OC)C=C(C=C1)C1CC(=O)C2=C(C1)NC(C)=C(C2C1=CC(OC)=C(OC)C=C1)C(=O)OC1CCCC1 |
InChi: | InChI=1S/C32H37NO7/c1-18-29(32(35)40-22-8-6-7-9-22)30(20-11-13-26(37-3)28(17-20)39-5)31-23(33-18)14-21(15-24(31)34)19-10-12-25(36-2)27(16-19)38-4/h10-13,16-17,21-22,30,33H,6-9,14-15H2,1-5H3 |
InChiKey: | InChIKey=IHZUKYNPZCARTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.