* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036217 |
| English Synonyms: | VITAS-BB TBB036217 |
| MDL Number.: | MFCD02224177 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)C1=C(C)NC2=C(C1C1=C(OC(C)C)C=CC=C1)C(=O)CC(C2)C1=CC(OC)=C(OC)C=C1 |
| InChi: | InChI=1S/C30H35NO6/c1-7-36-30(33)27-18(4)31-22-14-20(19-12-13-25(34-5)26(16-19)35-6)15-23(32)29(22)28(27)21-10-8-9-11-24(21)37-17(2)3/h8-13,16-17,20,28,31H,7,14-15H2,1-6H3 |
| InChiKey: | InChIKey=KOZMYXWYYAGKJH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.