* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036246 |
| English Synonyms: | VITAS-BB TBB036246 |
| MDL Number.: | MFCD02224237 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COC1=C(OC)C=C(C=C1)C1CC(=O)C2=C(C1)NC(C)=C(C2C1=C(Cl)C=CC=C1)C(=O)OC1CCCC1 |
| InChi: | InChI=1S/C30H32ClNO5/c1-17-27(30(34)37-20-8-4-5-9-20)28(21-10-6-7-11-22(21)31)29-23(32-17)14-19(15-24(29)33)18-12-13-25(35-2)26(16-18)36-3/h6-7,10-13,16,19-20,28,32H,4-5,8-9,14-15H2,1-3H3 |
| InChiKey: | InChIKey=SFIRFJDFDLLAFA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.