* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036254 |
| English Synonyms: | VITAS-BB TBB036254 |
| MDL Number.: | MFCD02224254 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCCOC(=O)C1=C(C)NC2=C(C1C1=C(Cl)C=C(Cl)C=C1)C(=O)CC(C2)C1=CC(OC)=C(OC)C=C1 |
| InChi: | InChI=1S/C28H29Cl2NO5/c1-5-10-36-28(33)25-15(2)31-21-11-17(16-6-9-23(34-3)24(13-16)35-4)12-22(32)27(21)26(25)19-8-7-18(29)14-20(19)30/h6-9,13-14,17,26,31H,5,10-12H2,1-4H3 |
| InChiKey: | InChIKey=MZCYKPYGPPTYPD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.