* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB016786 |
| English Synonyms: | VITAS-BB TBB016786 |
| MDL Number.: | MFCD02224260 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)C1=C(C)NC2=C(C1C1=C(C)C=CC=C1)C(=O)CC(C2)C1=CC(OC)=C(OC)C=C1 |
| InChi: | InChI=1S/C28H31NO5/c1-6-34-28(31)25-17(3)29-21-13-19(18-11-12-23(32-4)24(15-18)33-5)14-22(30)27(21)26(25)20-10-8-7-9-16(20)2/h7-12,15,19,26,29H,6,13-14H2,1-5H3 |
| InChiKey: | InChIKey=AYXJVKNHPVSBHU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.