* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036261 |
| English Synonyms: | VITAS-BB TBB036261 |
| MDL Number.: | MFCD02224279 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | COCCOC(=O)C1=C(C)NC2=C(C1C1=C(OC)C=CC(OC)=C1)C(=O)CC(C2)C1=CC(OC)=C(OC)C=C1 |
| InChi: | InChI=1S/C30H35NO8/c1-17-27(30(33)39-12-11-34-2)28(21-16-20(35-3)8-10-24(21)36-4)29-22(31-17)13-19(14-23(29)32)18-7-9-25(37-5)26(15-18)38-6/h7-10,15-16,19,28,31H,11-14H2,1-6H3 |
| InChiKey: | InChIKey=LDKYQUNQTXXYLB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.